C20H20N5O7S3- — CID 175269564
[4-[[4-carbamoyl-2-(4-methoxyanilino)-1,3-thiazol-5-yl]carbamoyl]-N-methylsulfonylanilino]methanesulfinate (PubChem CID 175269564) has the molecular formula C20H20N5O7S3- and a molecular weight of 538.61 g/mol. Its IUPAC name is [4-[[4-carbamoyl-2-(4-methoxyanilino)-1,3-thiazol-5-yl]carbamoyl]-N-methylsulfonylanilino]methanesulfinate.
| Compound Name | [4-[[4-carbamoyl-2-(4-methoxyanilino)-1,3-thiazol-5-yl]carbamoyl]-N-methylsulfonylanilino]methanesulfinate |
|---|---|
| PubChem CID | 175269564 |
| Molecular Formula | C20H20N5O7S3- |
| Molecular Weight | 538.61 g/mol |
| Exact Mass | 538.05 |
| IUPAC Name | [4-[[4-carbamoyl-2-(4-methoxyanilino)-1,3-thiazol-5-yl]carbamoyl]-N-methylsulfonylanilino]methanesulfinate |
| SMILES | COc1ccc(Nc2nc(C(N)=O)c(NC(=O)c3ccc(N(CS(=O)[O-])S(C)(=O)=O)cc3)s2)cc1 |
| InChI | InChI=1S/C20H21N5O7S3/c1-32-15-9-5-13(6-10-15)22-20-23-16(17(21)26)19(33-20)24-18(27)12-3-7-14(8-4-12)25(11-34(28)29)35(2,30)31/h3-10H,11H2,1-2H3,(H2,21,26)(H,22,23)(H,24,27)(H,28,29)/p-1 |
| InChIKey | CXLZHENFBBUWNH-UHFFFAOYSA-M |
| XLogP | 1.85 |
| TPSA | 183.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.61 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|