C14H12ClN3O2 — CID 83072934
2-chloro-6-(3,5-dimethoxyanilino)pyridine-4-carbonitrile (PubChem CID 83072934) has the molecular formula C14H12ClN3O2 and a molecular weight of 289.72 g/mol. Its IUPAC name is 2-chloro-6-(3,5-dimethoxyanilino)pyridine-4-carbonitrile.
| Compound Name | 2-chloro-6-(3,5-dimethoxyanilino)pyridine-4-carbonitrile |
|---|---|
| PubChem CID | 83072934 |
| Molecular Formula | C14H12ClN3O2 |
| Molecular Weight | 289.72 g/mol |
| Exact Mass | 289.06 |
| IUPAC Name | 2-chloro-6-(3,5-dimethoxyanilino)pyridine-4-carbonitrile |
| SMILES | COc1cc(Nc2cc(C#N)cc(Cl)n2)cc(OC)c1 |
| InChI | InChI=1S/C14H12ClN3O2/c1-19-11-5-10(6-12(7-11)20-2)17-14-4-9(8-16)3-13(15)18-14/h3-7H,1-2H3,(H,17,18) |
| InChIKey | KOUYVICSARLBPX-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 67.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.72 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|