C13H9ClFN3 — CID 83074701
2-chloro-6-(3-fluoro-4-methylanilino)pyridine-4-carbonitrile (PubChem CID 83074701) has the molecular formula C13H9ClFN3 and a molecular weight of 261.69 g/mol. Its IUPAC name is 2-chloro-6-(3-fluoro-4-methylanilino)pyridine-4-carbonitrile.
| Compound Name | 2-chloro-6-(3-fluoro-4-methylanilino)pyridine-4-carbonitrile |
|---|---|
| PubChem CID | 83074701 |
| Molecular Formula | C13H9ClFN3 |
| Molecular Weight | 261.69 g/mol |
| Exact Mass | 261.05 |
| IUPAC Name | 2-chloro-6-(3-fluoro-4-methylanilino)pyridine-4-carbonitrile |
| SMILES | Cc1ccc(Nc2cc(C#N)cc(Cl)n2)cc1F |
| InChI | InChI=1S/C13H9ClFN3/c1-8-2-3-10(6-11(8)15)17-13-5-9(7-16)4-12(14)18-13/h2-6H,1H3,(H,17,18) |
| InChIKey | NIKZXPOBPXFTMQ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.69 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|