C22H15F2N5 — CID 127032186
4-[[6-[4-[(E)-2-cyanoethenyl]-2-fluoro-6-methylanilino]-3-fluoro-2-pyridinyl]amino]benzonitrile (PubChem CID 127032186) has the molecular formula C22H15F2N5 and a molecular weight of 387.39 g/mol. Its IUPAC name is 4-[[6-[4-[(E)-2-cyanoethenyl]-2-fluoro-6-methylanilino]-3-fluoro-2-pyridinyl]amino]benzonitrile.
| Compound Name | 4-[[6-[4-[(E)-2-cyanoethenyl]-2-fluoro-6-methylanilino]-3-fluoro-2-pyridinyl]amino]benzonitrile |
|---|---|
| PubChem CID | 127032186 |
| Molecular Formula | C22H15F2N5 |
| Molecular Weight | 387.39 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | 4-[[6-[4-[(E)-2-cyanoethenyl]-2-fluoro-6-methylanilino]-3-fluoro-2-pyridinyl]amino]benzonitrile |
| SMILES | Cc1cc(/C=C/C#N)cc(F)c1Nc1ccc(F)c(Nc2ccc(C#N)cc2)n1 |
| InChI | InChI=1S/C22H15F2N5/c1-14-11-16(3-2-10-25)12-19(24)21(14)28-20-9-8-18(23)22(29-20)27-17-6-4-15(13-26)5-7-17/h2-9,11-12H,1H3,(H2,27,28,29)/b3-2+ |
| InChIKey | JRDYJNXQMAPBPP-NSCUHMNNSA-N |
| XLogP | 5.56 |
| TPSA | 84.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.39 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|