C28H23F3N6 — CID 11605744
4-methyl-2,6-bis(4-methylanilino)-5-[[2-(trifluoromethyl)phenyl]diazenyl]pyridine-3-carbonitrile (PubChem CID 11605744) has the molecular formula C28H23F3N6 and a molecular weight of 500.53 g/mol. Its IUPAC name is 4-methyl-2,6-bis(4-methylanilino)-5-[[2-(trifluoromethyl)phenyl]diazenyl]pyridine-3-carbonitrile.
| Compound Name | 4-methyl-2,6-bis(4-methylanilino)-5-[[2-(trifluoromethyl)phenyl]diazenyl]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 11605744 |
| Molecular Formula | C28H23F3N6 |
| Molecular Weight | 500.53 g/mol |
| Exact Mass | 500.19 |
| IUPAC Name | 4-methyl-2,6-bis(4-methylanilino)-5-[[2-(trifluoromethyl)phenyl]diazenyl]pyridine-3-carbonitrile |
| SMILES | Cc1ccc(Nc2nc(Nc3ccc(C)cc3)c(/N=N/c3ccccc3C(F)(F)F)c(C)c2C#N)cc1 |
| InChI | InChI=1S/C28H23F3N6/c1-17-8-12-20(13-9-17)33-26-22(16-32)19(3)25(27(35-26)34-21-14-10-18(2)11-15-21)37-36-24-7-5-4-6-23(24)28(29,30)31/h4-15H,1-3H3,(H2,33,34,35)/b37-36+ |
| InChIKey | FOICTPKVVFHDJU-BSRQYYOTSA-N |
| XLogP | 8.80 |
| TPSA | 85.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.53 |
| LogP ≤ 5 | 8.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|