C12H13N5O2 — CID 16742947
5-amino-3-(3,5-dimethoxyanilino)-1H-pyrazole-4-carbonitrile (PubChem CID 16742947) has the molecular formula C12H13N5O2 and a molecular weight of 259.27 g/mol. Its IUPAC name is 5-amino-3-(3,5-dimethoxyanilino)-1H-pyrazole-4-carbonitrile.
| Compound Name | 5-amino-3-(3,5-dimethoxyanilino)-1H-pyrazole-4-carbonitrile |
|---|---|
| PubChem CID | 16742947 |
| Molecular Formula | C12H13N5O2 |
| Molecular Weight | 259.27 g/mol |
| Exact Mass | 259.11 |
| IUPAC Name | 5-amino-3-(3,5-dimethoxyanilino)-1H-pyrazole-4-carbonitrile |
| SMILES | COc1cc(Nc2n[nH]c(N)c2C#N)cc(OC)c1 |
| InChI | InChI=1S/C12H13N5O2/c1-18-8-3-7(4-9(5-8)19-2)15-12-10(6-13)11(14)16-17-12/h3-5H,1-2H3,(H4,14,15,16,17) |
| InChIKey | ZFZUMYVWLBHTLO-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 108.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.27 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |