About 2-(5-methoxy-1,2-oxazol-4-yl)acetonitrile
2-(5-methoxy-1,2-oxazol-4-yl)acetonitrile (PubChem CID 84762526) has the molecular formula C6H6N2O2
and a molecular weight of 138.13 g/mol. Its IUPAC name is 2-(5-methoxy-1,2-oxazol-4-yl)acetonitrile.
Molecular Properties
| Compound Name | 2-(5-methoxy-1,2-oxazol-4-yl)acetonitrile |
| PubChem CID | 84762526 |
| Molecular Formula | C6H6N2O2 |
| Molecular Weight | 138.13 g/mol |
| Exact Mass | 138.04 |
| IUPAC Name | 2-(5-methoxy-1,2-oxazol-4-yl)acetonitrile |
| SMILES | COc1oncc1CC#N |
| InChI | InChI=1S/C6H6N2O2/c1-9-6-5(2-3-7)4-8-10-6/h4H,2H2,1H3 |
| InChIKey | PQEYYJMTGWEJPE-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 59.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.13 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(5-methoxy-1,2-oxazol-4-yl)acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-methoxy-1,2-oxazol-4-yl)acetonitrile?
The IUPAC name of 2-(5-methoxy-1,2-oxazol-4-yl)acetonitrile (CID 84762526) is 2-(5-methoxy-1,2-oxazol-4-yl)acetonitrile.
What is the SMILES notation for 2-(5-methoxy-1,2-oxazol-4-yl)acetonitrile?
The canonical SMILES for 2-(5-methoxy-1,2-oxazol-4-yl)acetonitrile is COc1oncc1CC#N.
What is the InChIKey of 2-(5-methoxy-1,2-oxazol-4-yl)acetonitrile?
The InChIKey is PQEYYJMTGWEJPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N2O2/c1-9-6-5(2-3-7)4-8-10-6/h4H,2H2,1H3.
What are the key properties of 2-(5-methoxy-1,2-oxazol-4-yl)acetonitrile?
2-(5-methoxy-1,2-oxazol-4-yl)acetonitrile has a molecular weight of 138.13 g/mol, XLogP of 0.75, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-methoxy-1,2-oxazol-4-yl)acetonitrile is sourced from PubChem (CID 84762526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).