C6H6N2O2 — CID 84762526
2-(5-methoxy-1,2-oxazol-4-yl)acetonitrile (PubChem CID 84762526) has the molecular formula C6H6N2O2 and a molecular weight of 138.13 g/mol. Its IUPAC name is 2-(5-methoxy-1,2-oxazol-4-yl)acetonitrile.
| Compound Name | 2-(5-methoxy-1,2-oxazol-4-yl)acetonitrile |
|---|---|
| PubChem CID | 84762526 |
| Molecular Formula | C6H6N2O2 |
| Molecular Weight | 138.13 g/mol |
| Exact Mass | 138.04 |
| IUPAC Name | 2-(5-methoxy-1,2-oxazol-4-yl)acetonitrile |
| SMILES | COc1oncc1CC#N |
| InChI | InChI=1S/C6H6N2O2/c1-9-6-5(2-3-7)4-8-10-6/h4H,2H2,1H3 |
| InChIKey | PQEYYJMTGWEJPE-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 59.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.13 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |