C6H10N2O2 — CID 82651286
1-(5-methoxy-1,2-oxazol-4-yl)ethanamine (PubChem CID 82651286) has the molecular formula C6H10N2O2 and a molecular weight of 142.16 g/mol. Its IUPAC name is 1-(5-methoxy-1,2-oxazol-4-yl)ethanamine.
| Compound Name | 1-(5-methoxy-1,2-oxazol-4-yl)ethanamine |
|---|---|
| PubChem CID | 82651286 |
| Molecular Formula | C6H10N2O2 |
| Molecular Weight | 142.16 g/mol |
| Exact Mass | 142.07 |
| IUPAC Name | 1-(5-methoxy-1,2-oxazol-4-yl)ethanamine |
| SMILES | COc1oncc1C(C)N |
| InChI | InChI=1S/C6H10N2O2/c1-4(7)5-3-8-10-6(5)9-2/h3-4H,7H2,1-2H3 |
| InChIKey | GHEWBJQMYFDLAY-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.16 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |