C8H8N2O2 — CID 117109992
5-methoxy-1,2-benzoxazol-4-amine (PubChem CID 117109992) has the molecular formula C8H8N2O2 and a molecular weight of 164.16 g/mol. Its IUPAC name is 5-methoxy-1,2-benzoxazol-4-amine.
| Compound Name | 5-methoxy-1,2-benzoxazol-4-amine |
|---|---|
| PubChem CID | 117109992 |
| Molecular Formula | C8H8N2O2 |
| Molecular Weight | 164.16 g/mol |
| Exact Mass | 164.06 |
| IUPAC Name | 5-methoxy-1,2-benzoxazol-4-amine |
| SMILES | COc1ccc2oncc2c1N |
| InChI | InChI=1S/C8H8N2O2/c1-11-7-3-2-6-5(8(7)9)4-10-12-6/h2-4H,9H2,1H3 |
| InChIKey | HDMNERMKYGERTL-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.16 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|