About 5,6-dimethoxyphenanthro[9,10-d][1,2]oxazole
5,6-dimethoxyphenanthro[9,10-d][1,2]oxazole (PubChem CID 11323437) has the molecular formula C17H13NO3
and a molecular weight of 279.30 g/mol. Its IUPAC name is 5,6-dimethoxyphenanthro[9,10-d][1,2]oxazole.
Molecular Properties
| Compound Name | 5,6-dimethoxyphenanthro[9,10-d][1,2]oxazole |
| PubChem CID | 11323437 |
| Molecular Formula | C17H13NO3 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | 5,6-dimethoxyphenanthro[9,10-d][1,2]oxazole |
| SMILES | COc1cc2c3ccccc3c3oncc3c2cc1OC |
| InChI | InChI=1S/C17H13NO3/c1-19-15-7-12-10-5-3-4-6-11(10)17-14(9-18-21-17)13(12)8-16(15)20-2/h3-9H,1-2H3 |
| InChIKey | HDKUMUPJTCJNTJ-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 44.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 5,6-dimethoxyphenanthro[9,10-d][1,2]oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-dimethoxyphenanthro[9,10-d][1,2]oxazole?
The IUPAC name of 5,6-dimethoxyphenanthro[9,10-d][1,2]oxazole (CID 11323437) is 5,6-dimethoxyphenanthro[9,10-d][1,2]oxazole.
What is the SMILES notation for 5,6-dimethoxyphenanthro[9,10-d][1,2]oxazole?
The canonical SMILES for 5,6-dimethoxyphenanthro[9,10-d][1,2]oxazole is COc1cc2c3ccccc3c3oncc3c2cc1OC.
What is the InChIKey of 5,6-dimethoxyphenanthro[9,10-d][1,2]oxazole?
The InChIKey is HDKUMUPJTCJNTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13NO3/c1-19-15-7-12-10-5-3-4-6-11(10)17-14(9-18-21-17)13(12)8-16(15)20-2/h3-9H,1-2H3.
What are the key properties of 5,6-dimethoxyphenanthro[9,10-d][1,2]oxazole?
5,6-dimethoxyphenanthro[9,10-d][1,2]oxazole has a molecular weight of 279.30 g/mol, XLogP of 4.15, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dimethoxyphenanthro[9,10-d][1,2]oxazole is sourced from PubChem (CID 11323437), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).