C9H9NO3Ti — CID 174490431
5,7-dimethoxy-1,2-benzoxazole;titanium (PubChem CID 174490431) has the molecular formula C9H9NO3Ti and a molecular weight of 227.04 g/mol. Its IUPAC name is 5,7-dimethoxy-1,2-benzoxazole;titanium.
| Compound Name | 5,7-dimethoxy-1,2-benzoxazole;titanium |
|---|---|
| PubChem CID | 174490431 |
| Molecular Formula | C9H9NO3Ti |
| Molecular Weight | 227.04 g/mol |
| Exact Mass | 227.01 |
| IUPAC Name | 5,7-dimethoxy-1,2-benzoxazole;titanium |
| SMILES | COc1cc(OC)c2oncc2c1.[Ti] |
| InChI | InChI=1S/C9H9NO3.Ti/c1-11-7-3-6-5-10-13-9(6)8(4-7)12-2;/h3-5H,1-2H3; |
| InChIKey | JDCCAKXVJAQOAN-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 44.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.04 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |