C18H18O5 — CID 10358261
2-(3,5-dimethoxyphenyl)-5,7-dimethoxy-1-benzofuran (PubChem CID 10358261) has the molecular formula C18H18O5 and a molecular weight of 314.34 g/mol. Its IUPAC name is 2-(3,5-dimethoxyphenyl)-5,7-dimethoxy-1-benzofuran.
| Compound Name | 2-(3,5-dimethoxyphenyl)-5,7-dimethoxy-1-benzofuran |
|---|---|
| PubChem CID | 10358261 |
| Molecular Formula | C18H18O5 |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | 2-(3,5-dimethoxyphenyl)-5,7-dimethoxy-1-benzofuran |
| SMILES | COc1cc(OC)cc(-c2cc3cc(OC)cc(OC)c3o2)c1 |
| InChI | InChI=1S/C18H18O5/c1-19-13-5-11(6-14(9-13)20-2)16-8-12-7-15(21-3)10-17(22-4)18(12)23-16/h5-10H,1-4H3 |
| InChIKey | ZRASJPKFENKLAX-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 50.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |