C22H22O4 — CID 162974982
2-(3,5-dimethoxyphenyl)-5,8-dimethyl-7,10-dihydrofuro[2,3-g][1]benzoxepine (PubChem CID 162974982) has the molecular formula C22H22O4 and a molecular weight of 350.41 g/mol. Its IUPAC name is 2-(3,5-dimethoxyphenyl)-5,8-dimethyl-7,10-dihydrofuro[2,3-g][1]benzoxepine.
| Compound Name | 2-(3,5-dimethoxyphenyl)-5,8-dimethyl-7,10-dihydrofuro[2,3-g][1]benzoxepine |
|---|---|
| PubChem CID | 162974982 |
| Molecular Formula | C22H22O4 |
| Molecular Weight | 350.41 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | 2-(3,5-dimethoxyphenyl)-5,8-dimethyl-7,10-dihydrofuro[2,3-g][1]benzoxepine |
| SMILES | COc1cc(OC)cc(-c2cc3cc(C)c4c(c3o2)CC=C(C)CO4)c1 |
| InChI | InChI=1S/C22H22O4/c1-13-5-6-19-21(25-12-13)14(2)7-16-10-20(26-22(16)19)15-8-17(23-3)11-18(9-15)24-4/h5,7-11H,6,12H2,1-4H3 |
| InChIKey | MQEQHGGPAYLCTD-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 40.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.41 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|