C17H20O2 — CID 132567017
2-(3,5-dimethoxyphenyl)-1,3,5-trimethylbenzene (PubChem CID 132567017) has the molecular formula C17H20O2 and a molecular weight of 256.34 g/mol. Its IUPAC name is 2-(3,5-dimethoxyphenyl)-1,3,5-trimethylbenzene.
| Compound Name | 2-(3,5-dimethoxyphenyl)-1,3,5-trimethylbenzene |
|---|---|
| PubChem CID | 132567017 |
| Molecular Formula | C17H20O2 |
| Molecular Weight | 256.34 g/mol |
| Exact Mass | 256.15 |
| IUPAC Name | 2-(3,5-dimethoxyphenyl)-1,3,5-trimethylbenzene |
| SMILES | COc1cc(OC)cc(-c2c(C)cc(C)cc2C)c1 |
| InChI | InChI=1S/C17H20O2/c1-11-6-12(2)17(13(3)7-11)14-8-15(18-4)10-16(9-14)19-5/h6-10H,1-5H3 |
| InChIKey | WPNBPWMTYQTCIE-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.34 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |