C14H18O3 — CID 135058890
2-butyl-5,7-dimethoxy-1-benzofuran (PubChem CID 135058890) has the molecular formula C14H18O3 and a molecular weight of 234.29 g/mol. Its IUPAC name is 2-butyl-5,7-dimethoxy-1-benzofuran.
| Compound Name | 2-butyl-5,7-dimethoxy-1-benzofuran |
|---|---|
| PubChem CID | 135058890 |
| Molecular Formula | C14H18O3 |
| Molecular Weight | 234.29 g/mol |
| Exact Mass | 234.13 |
| IUPAC Name | 2-butyl-5,7-dimethoxy-1-benzofuran |
| SMILES | CCCCc1cc2cc(OC)cc(OC)c2o1 |
| InChI | InChI=1S/C14H18O3/c1-4-5-6-11-7-10-8-12(15-2)9-13(16-3)14(10)17-11/h7-9H,4-6H2,1-3H3 |
| InChIKey | MHAAVWUFQJGSJS-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 31.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.29 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |