C14H16O6 — CID 162998450
3-[(1S,2R)-1,2-dihydroxypropyl]-6,8-dimethoxychromen-2-one (PubChem CID 162998450) has the molecular formula C14H16O6 and a molecular weight of 280.28 g/mol. Its IUPAC name is 3-[(1S,2R)-1,2-dihydroxypropyl]-6,8-dimethoxychromen-2-one.
| Compound Name | 3-[(1S,2R)-1,2-dihydroxypropyl]-6,8-dimethoxychromen-2-one |
|---|---|
| PubChem CID | 162998450 |
| Molecular Formula | C14H16O6 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | 3-[(1S,2R)-1,2-dihydroxypropyl]-6,8-dimethoxychromen-2-one |
| SMILES | COc1cc(OC)c2oc(=O)c([C@H](O)[C@@H](C)O)cc2c1 |
| InChI | InChI=1S/C14H16O6/c1-7(15)12(16)10-5-8-4-9(18-2)6-11(19-3)13(8)20-14(10)17/h4-7,12,15-16H,1-3H3/t7-,12-/m1/s1 |
| InChIKey | PXWYQHRGBXUBIF-JMCQJSRRSA-N |
| XLogP | 1.22 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|