C13H13NO6 — CID 134912070
N-hydroxy-6,8-dimethoxy-4-methyl-2-oxochromene-3-carboxamide (PubChem CID 134912070) has the molecular formula C13H13NO6 and a molecular weight of 279.25 g/mol. Its IUPAC name is N-hydroxy-6,8-dimethoxy-4-methyl-2-oxochromene-3-carboxamide.
| Compound Name | N-hydroxy-6,8-dimethoxy-4-methyl-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 134912070 |
| Molecular Formula | C13H13NO6 |
| Molecular Weight | 279.25 g/mol |
| Exact Mass | 279.07 |
| IUPAC Name | N-hydroxy-6,8-dimethoxy-4-methyl-2-oxochromene-3-carboxamide |
| SMILES | COc1cc(OC)c2oc(=O)c(C(=O)NO)c(C)c2c1 |
| InChI | InChI=1S/C13H13NO6/c1-6-8-4-7(18-2)5-9(19-3)11(8)20-13(16)10(6)12(15)14-17/h4-5,17H,1-3H3,(H,14,15) |
| InChIKey | AFEBTDRQHWMSIT-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 98.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.25 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|