C25H25NO6 — CID 4967889
N-(2,4-dimethoxyphenyl)-2-(2,3,5,9-tetramethyl-7-oxofuro[3,2-g]chromen-6-yl)acetamide (PubChem CID 4967889) has the molecular formula C25H25NO6 and a molecular weight of 435.48 g/mol. Its IUPAC name is N-(2,4-dimethoxyphenyl)-2-(2,3,5,9-tetramethyl-7-oxofuro[3,2-g]chromen-6-yl)acetamide.
| Compound Name | N-(2,4-dimethoxyphenyl)-2-(2,3,5,9-tetramethyl-7-oxofuro[3,2-g]chromen-6-yl)acetamide |
|---|---|
| PubChem CID | 4967889 |
| Molecular Formula | C25H25NO6 |
| Molecular Weight | 435.48 g/mol |
| Exact Mass | 435.17 |
| IUPAC Name | N-(2,4-dimethoxyphenyl)-2-(2,3,5,9-tetramethyl-7-oxofuro[3,2-g]chromen-6-yl)acetamide |
| SMILES | COc1ccc(NC(=O)Cc2c(C)c3cc4c(C)c(C)oc4c(C)c3oc2=O)c(OC)c1 |
| InChI | InChI=1S/C25H25NO6/c1-12-15(4)31-23-14(3)24-18(10-17(12)23)13(2)19(25(28)32-24)11-22(27)26-20-8-7-16(29-5)9-21(20)30-6/h7-10H,11H2,1-6H3,(H,26,27) |
| InChIKey | QGMYNFLPHHPCPL-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 90.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.48 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|