C20H20N2O5 — CID 4661483
3-[2-(2,4-dimethoxyanilino)-2-oxoethyl]-1-methylindole-2-carboxylic acid (PubChem CID 4661483) has the molecular formula C20H20N2O5 and a molecular weight of 368.39 g/mol. Its IUPAC name is 3-[2-(2,4-dimethoxyanilino)-2-oxoethyl]-1-methylindole-2-carboxylic acid.
| Compound Name | 3-[2-(2,4-dimethoxyanilino)-2-oxoethyl]-1-methylindole-2-carboxylic acid |
|---|---|
| PubChem CID | 4661483 |
| Molecular Formula | C20H20N2O5 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | 3-[2-(2,4-dimethoxyanilino)-2-oxoethyl]-1-methylindole-2-carboxylic acid |
| SMILES | COc1ccc(NC(=O)Cc2c(C(=O)O)n(C)c3ccccc23)c(OC)c1 |
| InChI | InChI=1S/C20H20N2O5/c1-22-16-7-5-4-6-13(16)14(19(22)20(24)25)11-18(23)21-15-9-8-12(26-2)10-17(15)27-3/h4-10H,11H2,1-3H3,(H,21,23)(H,24,25) |
| InChIKey | GEHFMYUELLGRIK-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|