C22H24N2O5 — CID 22330769
3-[2-(2,4-dimethoxy-N-methylanilino)-2-oxoethyl]-1-ethylindole-2-carboxylic acid (PubChem CID 22330769) has the molecular formula C22H24N2O5 and a molecular weight of 396.44 g/mol. Its IUPAC name is 3-[2-(2,4-dimethoxy-N-methylanilino)-2-oxoethyl]-1-ethylindole-2-carboxylic acid.
| Compound Name | 3-[2-(2,4-dimethoxy-N-methylanilino)-2-oxoethyl]-1-ethylindole-2-carboxylic acid |
|---|---|
| PubChem CID | 22330769 |
| Molecular Formula | C22H24N2O5 |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | 3-[2-(2,4-dimethoxy-N-methylanilino)-2-oxoethyl]-1-ethylindole-2-carboxylic acid |
| SMILES | CCn1c(C(=O)O)c(CC(=O)N(C)c2ccc(OC)cc2OC)c2ccccc21 |
| InChI | InChI=1S/C22H24N2O5/c1-5-24-17-9-7-6-8-15(17)16(21(24)22(26)27)13-20(25)23(2)18-11-10-14(28-3)12-19(18)29-4/h6-12H,5,13H2,1-4H3,(H,26,27) |
| InChIKey | YCCGAGVJJVICHE-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|