C13H19NO4 — CID 115178639
N-(2,4-dimethoxyphenyl)-2-hydroxy-N,2-dimethylpropanamide (PubChem CID 115178639) has the molecular formula C13H19NO4 and a molecular weight of 253.30 g/mol. Its IUPAC name is N-(2,4-dimethoxyphenyl)-2-hydroxy-N,2-dimethylpropanamide.
| Compound Name | N-(2,4-dimethoxyphenyl)-2-hydroxy-N,2-dimethylpropanamide |
|---|---|
| PubChem CID | 115178639 |
| Molecular Formula | C13H19NO4 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | N-(2,4-dimethoxyphenyl)-2-hydroxy-N,2-dimethylpropanamide |
| SMILES | COc1ccc(N(C)C(=O)C(C)(C)O)c(OC)c1 |
| InChI | InChI=1S/C13H19NO4/c1-13(2,16)12(15)14(3)10-7-6-9(17-4)8-11(10)18-5/h6-8,16H,1-5H3 |
| InChIKey | KUIOATLZBLSMEG-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |