C16H9F14NO4 — CID 91727289
N-(2,4-dimethoxyphenyl)-2,2,3,3,4,4,4-heptafluoro-N-(2,2,3,3,4,4,4-heptafluorobutanoyl)butanamide (PubChem CID 91727289) has the molecular formula C16H9F14NO4 and a molecular weight of 545.22 g/mol. Its IUPAC name is N-(2,4-dimethoxyphenyl)-2,2,3,3,4,4,4-heptafluoro-N-(2,2,3,3,4,4,4-heptafluorobutanoyl)butanamide.
| Compound Name | N-(2,4-dimethoxyphenyl)-2,2,3,3,4,4,4-heptafluoro-N-(2,2,3,3,4,4,4-heptafluorobutanoyl)butanamide |
|---|---|
| PubChem CID | 91727289 |
| Molecular Formula | C16H9F14NO4 |
| Molecular Weight | 545.22 g/mol |
| Exact Mass | 545.03 |
| IUPAC Name | N-(2,4-dimethoxyphenyl)-2,2,3,3,4,4,4-heptafluoro-N-(2,2,3,3,4,4,4-heptafluorobutanoyl)butanamide |
| SMILES | COc1ccc(N(C(=O)C(F)(F)C(F)(F)C(F)(F)F)C(=O)C(F)(F)C(F)(F)C(F)(F)F)c(OC)c1 |
| InChI | InChI=1S/C16H9F14NO4/c1-34-6-3-4-7(8(5-6)35-2)31(9(32)11(17,18)13(21,22)15(25,26)27)10(33)12(19,20)14(23,24)16(28,29)30/h3-5H,1-2H3 |
| InChIKey | MDOLZAYCRPITMB-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.22 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|