C14H17Cl2NO6 — CID 67929431
2-chloroethyl N-(2-chloroethoxycarbonyl)-N-(2,4-dimethoxyphenyl)carbamate (PubChem CID 67929431) has the molecular formula C14H17Cl2NO6 and a molecular weight of 366.20 g/mol. Its IUPAC name is 2-chloroethyl N-(2-chloroethoxycarbonyl)-N-(2,4-dimethoxyphenyl)carbamate.
| Compound Name | 2-chloroethyl N-(2-chloroethoxycarbonyl)-N-(2,4-dimethoxyphenyl)carbamate |
|---|---|
| PubChem CID | 67929431 |
| Molecular Formula | C14H17Cl2NO6 |
| Molecular Weight | 366.20 g/mol |
| Exact Mass | 365.04 |
| IUPAC Name | 2-chloroethyl N-(2-chloroethoxycarbonyl)-N-(2,4-dimethoxyphenyl)carbamate |
| SMILES | COc1ccc(N(C(=O)OCCCl)C(=O)OCCCl)c(OC)c1 |
| InChI | InChI=1S/C14H17Cl2NO6/c1-20-10-3-4-11(12(9-10)21-2)17(13(18)22-7-5-15)14(19)23-8-6-16/h3-4,9H,5-8H2,1-2H3 |
| InChIKey | JGTXXXNTMPZEEH-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.20 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|