C13H19NO4 — CID 100521202
(2S)-2-(2,4-dimethoxy-N-methylanilino)butanoic acid (PubChem CID 100521202) has the molecular formula C13H19NO4 and a molecular weight of 253.30 g/mol. Its IUPAC name is (2S)-2-(2,4-dimethoxy-N-methylanilino)butanoic acid.
| Compound Name | (2S)-2-(2,4-dimethoxy-N-methylanilino)butanoic acid |
|---|---|
| PubChem CID | 100521202 |
| Molecular Formula | C13H19NO4 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | (2S)-2-(2,4-dimethoxy-N-methylanilino)butanoic acid |
| SMILES | CC[C@@H](C(=O)O)N(C)c1ccc(OC)cc1OC |
| InChI | InChI=1S/C13H19NO4/c1-5-10(13(15)16)14(2)11-7-6-9(17-3)8-12(11)18-4/h6-8,10H,5H2,1-4H3,(H,15,16)/t10-/m0/s1 |
| InChIKey | CAIYVQHVWRAKGW-JTQLQIEISA-N |
| XLogP | 2.00 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|