(2S)-2-(2-methoxy-N,5-dimethylanilino)butanoic acid

C13H19NO3 — CID 100521470

IUPAC(2S)-2-(2-methoxy-N,5-dimethylanilino)butanoic acid
SMILESCC[C@@H](C(=O)O)N(C)c1cc(C)ccc1OC
InChIInChI=1S/C13H19NO3/c1-5-10(13(15)16)14(3)11-8-9(2)6-7-12(11)17-4/h6-8,10H,5H2,1-4H3,(H,15,16)/t10-/m0/s1
InChIKeyPIFGLFPCIAKSNF-JTQLQIEISA-N
MW237.30 g/mol
LogP2.30
Rot. Bonds5

About (2S)-2-(2-methoxy-N,5-dimethylanilino)butanoic acid

(2S)-2-(2-methoxy-N,5-dimethylanilino)butanoic acid (PubChem CID 100521470) has the molecular formula C13H19NO3 and a molecular weight of 237.30 g/mol. Its IUPAC name is (2S)-2-(2-methoxy-N,5-dimethylanilino)butanoic acid.

Molecular Properties

Compound Name(2S)-2-(2-methoxy-N,5-dimethylanilino)butanoic acid
PubChem CID100521470
Molecular FormulaC13H19NO3
Molecular Weight237.30 g/mol
Exact Mass237.14
IUPAC Name(2S)-2-(2-methoxy-N,5-dimethylanilino)butanoic acid
SMILESCC[C@@H](C(=O)O)N(C)c1cc(C)ccc1OC
InChIInChI=1S/C13H19NO3/c1-5-10(13(15)16)14(3)11-8-9(2)6-7-12(11)17-4/h6-8,10H,5H2,1-4H3,(H,15,16)/t10-/m0/s1
InChIKeyPIFGLFPCIAKSNF-JTQLQIEISA-N
XLogP2.30
TPSA49.77 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500237.30
LogP ≤ 52.30
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze (2S)-2-(2-methoxy-N,5-dimethylanilino)butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2S)-2-(2-methoxy-N,5-dimethylanilino)butanoic acid?
The IUPAC name of (2S)-2-(2-methoxy-N,5-dimethylanilino)butanoic acid (CID 100521470) is (2S)-2-(2-methoxy-N,5-dimethylanilino)butanoic acid.
What is the SMILES notation for (2S)-2-(2-methoxy-N,5-dimethylanilino)butanoic acid?
The canonical SMILES for (2S)-2-(2-methoxy-N,5-dimethylanilino)butanoic acid is CC[C@@H](C(=O)O)N(C)c1cc(C)ccc1OC.
What is the InChIKey of (2S)-2-(2-methoxy-N,5-dimethylanilino)butanoic acid?
The InChIKey is PIFGLFPCIAKSNF-JTQLQIEISA-N. The full InChI is InChI=1S/C13H19NO3/c1-5-10(13(15)16)14(3)11-8-9(2)6-7-12(11)17-4/h6-8,10H,5H2,1-4H3,(H,15,16)/t10-/m0/s1.
What are the key properties of (2S)-2-(2-methoxy-N,5-dimethylanilino)butanoic acid?
(2S)-2-(2-methoxy-N,5-dimethylanilino)butanoic acid has a molecular weight of 237.30 g/mol, XLogP of 2.30, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-(2-methoxy-N,5-dimethylanilino)butanoic acid is sourced from PubChem (CID 100521470), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).