C12H17NO4 — CID 125041871
(2R)-2-(2,5-dimethoxy-N-methylanilino)propanoic acid (PubChem CID 125041871) has the molecular formula C12H17NO4 and a molecular weight of 239.27 g/mol. Its IUPAC name is (2R)-2-(2,5-dimethoxy-N-methylanilino)propanoic acid.
| Compound Name | (2R)-2-(2,5-dimethoxy-N-methylanilino)propanoic acid |
|---|---|
| PubChem CID | 125041871 |
| Molecular Formula | C12H17NO4 |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.12 |
| IUPAC Name | (2R)-2-(2,5-dimethoxy-N-methylanilino)propanoic acid |
| SMILES | COc1ccc(OC)c(N(C)[C@H](C)C(=O)O)c1 |
| InChI | InChI=1S/C12H17NO4/c1-8(12(14)15)13(2)10-7-9(16-3)5-6-11(10)17-4/h5-8H,1-4H3,(H,14,15)/t8-/m1/s1 |
| InChIKey | CPQIDIJGYJGWQK-MRVPVSSYSA-N |
| XLogP | 1.61 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |