C11H15NO3S — CID 115167004
N-(2,5-dimethoxyphenyl)-N-methyl-2-sulfanylacetamide (PubChem CID 115167004) has the molecular formula C11H15NO3S and a molecular weight of 241.31 g/mol. Its IUPAC name is N-(2,5-dimethoxyphenyl)-N-methyl-2-sulfanylacetamide.
| Compound Name | N-(2,5-dimethoxyphenyl)-N-methyl-2-sulfanylacetamide |
|---|---|
| PubChem CID | 115167004 |
| Molecular Formula | C11H15NO3S |
| Molecular Weight | 241.31 g/mol |
| Exact Mass | 241.08 |
| IUPAC Name | N-(2,5-dimethoxyphenyl)-N-methyl-2-sulfanylacetamide |
| SMILES | COc1ccc(OC)c(N(C)C(=O)CS)c1 |
| InChI | InChI=1S/C11H15NO3S/c1-12(11(13)7-16)9-6-8(14-2)4-5-10(9)15-3/h4-6,16H,7H2,1-3H3 |
| InChIKey | AWHCSHHFPAZONJ-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 38.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.31 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|