C28H32N2O8 — CID 21058626
dimethyl 2,5-bis(2,5-dimethoxy-N-methylanilino)benzene-1,4-dicarboxylate (PubChem CID 21058626) has the molecular formula C28H32N2O8 and a molecular weight of 524.57 g/mol. Its IUPAC name is dimethyl 2,5-bis(2,5-dimethoxy-N-methylanilino)benzene-1,4-dicarboxylate.
| Compound Name | dimethyl 2,5-bis(2,5-dimethoxy-N-methylanilino)benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 21058626 |
| Molecular Formula | C28H32N2O8 |
| Molecular Weight | 524.57 g/mol |
| Exact Mass | 524.22 |
| IUPAC Name | dimethyl 2,5-bis(2,5-dimethoxy-N-methylanilino)benzene-1,4-dicarboxylate |
| SMILES | COC(=O)c1cc(N(C)c2cc(OC)ccc2OC)c(C(=O)OC)cc1N(C)c1cc(OC)ccc1OC |
| InChI | InChI=1S/C28H32N2O8/c1-29(23-13-17(33-3)9-11-25(23)35-5)21-15-20(28(32)38-8)22(16-19(21)27(31)37-7)30(2)24-14-18(34-4)10-12-26(24)36-6/h9-16H,1-8H3 |
| InChIKey | BLFJPGZWTQENLK-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 96.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.57 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |