C13H17NO5 — CID 115174206
methyl 3-(2,5-dimethoxy-N-methylanilino)-3-oxopropanoate (PubChem CID 115174206) has the molecular formula C13H17NO5 and a molecular weight of 267.28 g/mol. Its IUPAC name is methyl 3-(2,5-dimethoxy-N-methylanilino)-3-oxopropanoate.
| Compound Name | methyl 3-(2,5-dimethoxy-N-methylanilino)-3-oxopropanoate |
|---|---|
| PubChem CID | 115174206 |
| Molecular Formula | C13H17NO5 |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | methyl 3-(2,5-dimethoxy-N-methylanilino)-3-oxopropanoate |
| SMILES | COC(=O)CC(=O)N(C)c1cc(OC)ccc1OC |
| InChI | InChI=1S/C13H17NO5/c1-14(12(15)8-13(16)19-4)10-7-9(17-2)5-6-11(10)18-3/h5-7H,8H2,1-4H3 |
| InChIKey | MMKABRVRHQVGFE-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|