C21H22N2O3 — CID 22330767
3-[2-(N,2-dimethylanilino)-2-oxoethyl]-1-ethylindole-2-carboxylic acid (PubChem CID 22330767) has the molecular formula C21H22N2O3 and a molecular weight of 350.42 g/mol. Its IUPAC name is 3-[2-(N,2-dimethylanilino)-2-oxoethyl]-1-ethylindole-2-carboxylic acid.
| Compound Name | 3-[2-(N,2-dimethylanilino)-2-oxoethyl]-1-ethylindole-2-carboxylic acid |
|---|---|
| PubChem CID | 22330767 |
| Molecular Formula | C21H22N2O3 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | 3-[2-(N,2-dimethylanilino)-2-oxoethyl]-1-ethylindole-2-carboxylic acid |
| SMILES | CCn1c(C(=O)O)c(CC(=O)N(C)c2ccccc2C)c2ccccc21 |
| InChI | InChI=1S/C21H22N2O3/c1-4-23-18-12-8-6-10-15(18)16(20(23)21(25)26)13-19(24)22(3)17-11-7-5-9-14(17)2/h5-12H,4,13H2,1-3H3,(H,25,26) |
| InChIKey | LIXVINNOXKPWRJ-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 62.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|