C19H24N2O3 — CID 15999504
3-[2-(azepan-1-yl)-2-oxoethyl]-1-ethylindole-2-carboxylic acid (PubChem CID 15999504) has the molecular formula C19H24N2O3 and a molecular weight of 328.41 g/mol. Its IUPAC name is 3-[2-(azepan-1-yl)-2-oxoethyl]-1-ethylindole-2-carboxylic acid.
| Compound Name | 3-[2-(azepan-1-yl)-2-oxoethyl]-1-ethylindole-2-carboxylic acid |
|---|---|
| PubChem CID | 15999504 |
| Molecular Formula | C19H24N2O3 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | 3-[2-(azepan-1-yl)-2-oxoethyl]-1-ethylindole-2-carboxylic acid |
| SMILES | CCn1c(C(=O)O)c(CC(=O)N2CCCCCC2)c2ccccc21 |
| InChI | InChI=1S/C19H24N2O3/c1-2-21-16-10-6-5-9-14(16)15(18(21)19(23)24)13-17(22)20-11-7-3-4-8-12-20/h5-6,9-10H,2-4,7-8,11-13H2,1H3,(H,23,24) |
| InChIKey | QAGMPJLUHZLUCS-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 62.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|