C28H34N4O2 — CID 17441584
1-(1-ethyl-2-phenylindol-3-yl)-2-[4-(2-oxo-2-pyrrolidin-1-ylethyl)piperazin-1-yl]ethanone (PubChem CID 17441584) has the molecular formula C28H34N4O2 and a molecular weight of 458.61 g/mol. Its IUPAC name is 1-(1-ethyl-2-phenylindol-3-yl)-2-[4-(2-oxo-2-pyrrolidin-1-ylethyl)piperazin-1-yl]ethanone.
| Compound Name | 1-(1-ethyl-2-phenylindol-3-yl)-2-[4-(2-oxo-2-pyrrolidin-1-ylethyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 17441584 |
| Molecular Formula | C28H34N4O2 |
| Molecular Weight | 458.61 g/mol |
| Exact Mass | 458.27 |
| IUPAC Name | 1-(1-ethyl-2-phenylindol-3-yl)-2-[4-(2-oxo-2-pyrrolidin-1-ylethyl)piperazin-1-yl]ethanone |
| SMILES | CCn1c(-c2ccccc2)c(C(=O)CN2CCN(CC(=O)N3CCCC3)CC2)c2ccccc21 |
| InChI | InChI=1S/C28H34N4O2/c1-2-32-24-13-7-6-12-23(24)27(28(32)22-10-4-3-5-11-22)25(33)20-29-16-18-30(19-17-29)21-26(34)31-14-8-9-15-31/h3-7,10-13H,2,8-9,14-21H2,1H3 |
| InChIKey | CVEQEBAZHXVGOD-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 48.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.61 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |