C25H29N3O2 — CID 87017632
2-[1-[2-(1-ethyl-2-phenylindol-3-yl)-2-oxoethyl]piperidin-4-yl]acetamide (PubChem CID 87017632) has the molecular formula C25H29N3O2 and a molecular weight of 403.53 g/mol. Its IUPAC name is 2-[1-[2-(1-ethyl-2-phenylindol-3-yl)-2-oxoethyl]piperidin-4-yl]acetamide.
| Compound Name | 2-[1-[2-(1-ethyl-2-phenylindol-3-yl)-2-oxoethyl]piperidin-4-yl]acetamide |
|---|---|
| PubChem CID | 87017632 |
| Molecular Formula | C25H29N3O2 |
| Molecular Weight | 403.53 g/mol |
| Exact Mass | 403.23 |
| IUPAC Name | 2-[1-[2-(1-ethyl-2-phenylindol-3-yl)-2-oxoethyl]piperidin-4-yl]acetamide |
| SMILES | CCn1c(-c2ccccc2)c(C(=O)CN2CCC(CC(N)=O)CC2)c2ccccc21 |
| InChI | InChI=1S/C25H29N3O2/c1-2-28-21-11-7-6-10-20(21)24(25(28)19-8-4-3-5-9-19)22(29)17-27-14-12-18(13-15-27)16-23(26)30/h3-11,18H,2,12-17H2,1H3,(H2,26,30) |
| InChIKey | YNHNYDLLIRLBMU-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 68.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.53 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |