C23H18ClNO — CID 154139542
(2-chlorophenyl)-(1-ethyl-2-phenylindol-3-yl)methanone (PubChem CID 154139542) has the molecular formula C23H18ClNO and a molecular weight of 359.86 g/mol. Its IUPAC name is (2-chlorophenyl)-(1-ethyl-2-phenylindol-3-yl)methanone.
| Compound Name | (2-chlorophenyl)-(1-ethyl-2-phenylindol-3-yl)methanone |
|---|---|
| PubChem CID | 154139542 |
| Molecular Formula | C23H18ClNO |
| Molecular Weight | 359.86 g/mol |
| Exact Mass | 359.11 |
| IUPAC Name | (2-chlorophenyl)-(1-ethyl-2-phenylindol-3-yl)methanone |
| SMILES | CCn1c(-c2ccccc2)c(C(=O)c2ccccc2Cl)c2ccccc21 |
| InChI | InChI=1S/C23H18ClNO/c1-2-25-20-15-9-7-13-18(20)21(22(25)16-10-4-3-5-11-16)23(26)17-12-6-8-14-19(17)24/h3-15H,2H2,1H3 |
| InChIKey | GMGOAAYOUBDRGR-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.86 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |