C27H24N3O+ — CID 8855216
2-(3-ethenylbenzimidazol-1-ium-1-yl)-1-(1-ethyl-2-phenylindol-3-yl)ethanone (PubChem CID 8855216) has the molecular formula C27H24N3O+ and a molecular weight of 406.51 g/mol. Its IUPAC name is 2-(3-ethenylbenzimidazol-1-ium-1-yl)-1-(1-ethyl-2-phenylindol-3-yl)ethanone.
| Compound Name | 2-(3-ethenylbenzimidazol-1-ium-1-yl)-1-(1-ethyl-2-phenylindol-3-yl)ethanone |
|---|---|
| PubChem CID | 8855216 |
| Molecular Formula | C27H24N3O+ |
| Molecular Weight | 406.51 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | 2-(3-ethenylbenzimidazol-1-ium-1-yl)-1-(1-ethyl-2-phenylindol-3-yl)ethanone |
| SMILES | C=Cn1c[n+](CC(=O)c2c(-c3ccccc3)n(CC)c3ccccc23)c2ccccc21 |
| InChI | InChI=1S/C27H24N3O/c1-3-28-19-29(24-17-11-10-16-23(24)28)18-25(31)26-21-14-8-9-15-22(21)30(4-2)27(26)20-12-6-5-7-13-20/h3,5-17,19H,1,4,18H2,2H3/q+1 |
| InChIKey | YQTDSZQMCIYBDO-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 30.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.51 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|