C26H27N2O+ — CID 8877422
1-(1-ethyl-2-phenylindol-3-yl)-2-(4-propylpyridin-1-ium-1-yl)ethanone (PubChem CID 8877422) has the molecular formula C26H27N2O+ and a molecular weight of 383.52 g/mol. Its IUPAC name is 1-(1-ethyl-2-phenylindol-3-yl)-2-(4-propylpyridin-1-ium-1-yl)ethanone.
| Compound Name | 1-(1-ethyl-2-phenylindol-3-yl)-2-(4-propylpyridin-1-ium-1-yl)ethanone |
|---|---|
| PubChem CID | 8877422 |
| Molecular Formula | C26H27N2O+ |
| Molecular Weight | 383.52 g/mol |
| Exact Mass | 383.21 |
| IUPAC Name | 1-(1-ethyl-2-phenylindol-3-yl)-2-(4-propylpyridin-1-ium-1-yl)ethanone |
| SMILES | CCCc1cc[n+](CC(=O)c2c(-c3ccccc3)n(CC)c3ccccc23)cc1 |
| InChI | InChI=1S/C26H27N2O/c1-3-10-20-15-17-27(18-16-20)19-24(29)25-22-13-8-9-14-23(22)28(4-2)26(25)21-11-6-5-7-12-21/h5-9,11-18H,3-4,10,19H2,1-2H3/q+1 |
| InChIKey | OHRNOWBCIGMJIT-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 25.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.52 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|