C23H20N3O2+ — CID 8831837
1-[2-(1-methyl-2-phenylindol-3-yl)-2-oxoethyl]pyridin-1-ium-3-carboxamide (PubChem CID 8831837) has the molecular formula C23H20N3O2+ and a molecular weight of 370.43 g/mol. Its IUPAC name is 1-[2-(1-methyl-2-phenylindol-3-yl)-2-oxoethyl]pyridin-1-ium-3-carboxamide.
| Compound Name | 1-[2-(1-methyl-2-phenylindol-3-yl)-2-oxoethyl]pyridin-1-ium-3-carboxamide |
|---|---|
| PubChem CID | 8831837 |
| Molecular Formula | C23H20N3O2+ |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | 1-[2-(1-methyl-2-phenylindol-3-yl)-2-oxoethyl]pyridin-1-ium-3-carboxamide |
| SMILES | Cn1c(-c2ccccc2)c(C(=O)C[n+]2cccc(C(N)=O)c2)c2ccccc21 |
| InChI | InChI=1S/C23H19N3O2/c1-25-19-12-6-5-11-18(19)21(22(25)16-8-3-2-4-9-16)20(27)15-26-13-7-10-17(14-26)23(24)28/h2-14H,15H2,1H3,(H-,24,28)/p+1 |
| InChIKey | ORGZWDHJFRJDGH-UHFFFAOYSA-O |
| XLogP | 3.11 |
| TPSA | 68.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|