C21H31N5OS — CID 35952699
2-[4-[(3-ethyl-2-sulfanylidenebenzimidazol-1-yl)methyl]piperazin-1-yl]-1-piperidin-1-ylethanone (PubChem CID 35952699) has the molecular formula C21H31N5OS and a molecular weight of 401.58 g/mol. Its IUPAC name is 2-[4-[(3-ethyl-2-sulfanylidenebenzimidazol-1-yl)methyl]piperazin-1-yl]-1-piperidin-1-ylethanone.
| Compound Name | 2-[4-[(3-ethyl-2-sulfanylidenebenzimidazol-1-yl)methyl]piperazin-1-yl]-1-piperidin-1-ylethanone |
|---|---|
| PubChem CID | 35952699 |
| Molecular Formula | C21H31N5OS |
| Molecular Weight | 401.58 g/mol |
| Exact Mass | 401.22 |
| IUPAC Name | 2-[4-[(3-ethyl-2-sulfanylidenebenzimidazol-1-yl)methyl]piperazin-1-yl]-1-piperidin-1-ylethanone |
| SMILES | CCn1c(=S)n(CN2CCN(CC(=O)N3CCCCC3)CC2)c2ccccc21 |
| InChI | InChI=1S/C21H31N5OS/c1-2-25-18-8-4-5-9-19(18)26(21(25)28)17-23-14-12-22(13-15-23)16-20(27)24-10-6-3-7-11-24/h4-5,8-9H,2-3,6-7,10-17H2,1H3 |
| InChIKey | WIRYINOUAYXPQR-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 36.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.58 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|