C25H31N3O3 — CID 6615633
3-[2-[3-[benzyl(ethyl)amino]propylamino]-2-oxoethyl]-1-ethylindole-2-carboxylic acid (PubChem CID 6615633) has the molecular formula C25H31N3O3 and a molecular weight of 421.54 g/mol. Its IUPAC name is 3-[2-[3-[benzyl(ethyl)amino]propylamino]-2-oxoethyl]-1-ethylindole-2-carboxylic acid.
| Compound Name | 3-[2-[3-[benzyl(ethyl)amino]propylamino]-2-oxoethyl]-1-ethylindole-2-carboxylic acid |
|---|---|
| PubChem CID | 6615633 |
| Molecular Formula | C25H31N3O3 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.24 |
| IUPAC Name | 3-[2-[3-[benzyl(ethyl)amino]propylamino]-2-oxoethyl]-1-ethylindole-2-carboxylic acid |
| SMILES | CCN(CCCNC(=O)Cc1c(C(=O)O)n(CC)c2ccccc12)Cc1ccccc1 |
| InChI | InChI=1S/C25H31N3O3/c1-3-27(18-19-11-6-5-7-12-19)16-10-15-26-23(29)17-21-20-13-8-9-14-22(20)28(4-2)24(21)25(30)31/h5-9,11-14H,3-4,10,15-18H2,1-2H3,(H,26,29)(H,30,31) |
| InChIKey | GADLZZJFGLKVSB-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 74.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|