C19H27Cl2N3O — CID 119897269
2-amino-N-[3-(dibenzylamino)propyl]acetamide;dihydrochloride (PubChem CID 119897269) has the molecular formula C19H27Cl2N3O and a molecular weight of 384.35 g/mol. Its IUPAC name is 2-amino-N-[3-(dibenzylamino)propyl]acetamide;dihydrochloride.
| Compound Name | 2-amino-N-[3-(dibenzylamino)propyl]acetamide;dihydrochloride |
|---|---|
| PubChem CID | 119897269 |
| Molecular Formula | C19H27Cl2N3O |
| Molecular Weight | 384.35 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | 2-amino-N-[3-(dibenzylamino)propyl]acetamide;dihydrochloride |
| SMILES | Cl.Cl.NCC(=O)NCCCN(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C19H25N3O.2ClH/c20-14-19(23)21-12-7-13-22(15-17-8-3-1-4-9-17)16-18-10-5-2-6-11-18;;/h1-6,8-11H,7,12-16,20H2,(H,21,23);2*1H |
| InChIKey | FYQSLJANZFSYIG-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.35 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|