C17H14O7 — CID 69119541
2-(2,3-dihydroxyphenyl)-3-hydroxy-6,8-dimethoxychromen-4-one (PubChem CID 69119541) has the molecular formula C17H14O7 and a molecular weight of 330.29 g/mol. Its IUPAC name is 2-(2,3-dihydroxyphenyl)-3-hydroxy-6,8-dimethoxychromen-4-one.
| Compound Name | 2-(2,3-dihydroxyphenyl)-3-hydroxy-6,8-dimethoxychromen-4-one |
|---|---|
| PubChem CID | 69119541 |
| Molecular Formula | C17H14O7 |
| Molecular Weight | 330.29 g/mol |
| Exact Mass | 330.07 |
| IUPAC Name | 2-(2,3-dihydroxyphenyl)-3-hydroxy-6,8-dimethoxychromen-4-one |
| SMILES | COc1cc(OC)c2oc(-c3cccc(O)c3O)c(O)c(=O)c2c1 |
| InChI | InChI=1S/C17H14O7/c1-22-8-6-10-14(20)15(21)17(24-16(10)12(7-8)23-2)9-4-3-5-11(18)13(9)19/h3-7,18-19,21H,1-2H3 |
| InChIKey | AHZSYLPVDFOGDE-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 109.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.29 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|