C15H10O6 — CID 153409103
2-(2,3-dihydroxyphenyl)-3,7-dihydroxychromen-4-one (PubChem CID 153409103) has the molecular formula C15H10O6 and a molecular weight of 286.24 g/mol. Its IUPAC name is 2-(2,3-dihydroxyphenyl)-3,7-dihydroxychromen-4-one.
| Compound Name | 2-(2,3-dihydroxyphenyl)-3,7-dihydroxychromen-4-one |
|---|---|
| PubChem CID | 153409103 |
| Molecular Formula | C15H10O6 |
| Molecular Weight | 286.24 g/mol |
| Exact Mass | 286.05 |
| IUPAC Name | 2-(2,3-dihydroxyphenyl)-3,7-dihydroxychromen-4-one |
| SMILES | O=c1c(O)c(-c2cccc(O)c2O)oc2cc(O)ccc12 |
| InChI | InChI=1S/C15H10O6/c16-7-4-5-8-11(6-7)21-15(14(20)13(8)19)9-2-1-3-10(17)12(9)18/h1-6,16-18,20H |
| InChIKey | UCMIQMOEQFKLNY-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 111.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.24 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|