C30H22O13 — CID 163184579
2-[2-[(2R,3S,4S)-3,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-chromen-4-yl]-3,4,5-trihydroxyphenyl]-3,7-dihydroxychromen-4-one (PubChem CID 163184579) has the molecular formula C30H22O13 and a molecular weight of 590.49 g/mol. Its IUPAC name is 2-[2-[(2R,3S,4S)-3,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-chromen-4-yl]-3,4,5-trihydroxyphenyl]-3,7-dihydroxychromen-4-one.
| Compound Name | 2-[2-[(2R,3S,4S)-3,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-chromen-4-yl]-3,4,5-trihydroxyphenyl]-3,7-dihydroxychromen-4-one |
|---|---|
| PubChem CID | 163184579 |
| Molecular Formula | C30H22O13 |
| Molecular Weight | 590.49 g/mol |
| Exact Mass | 590.11 |
| IUPAC Name | 2-[2-[(2R,3S,4S)-3,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-chromen-4-yl]-3,4,5-trihydroxyphenyl]-3,7-dihydroxychromen-4-one |
| SMILES | O=c1c(O)c(-c2cc(O)c(O)c(O)c2[C@@H]2c3ccc(O)cc3O[C@H](c3cc(O)c(O)c(O)c3)[C@H]2O)oc2cc(O)ccc12 |
| InChI | InChI=1S/C30H22O13/c31-11-1-3-13-19(7-11)42-29(10-5-16(33)24(37)17(34)6-10)27(40)21(13)22-15(9-18(35)25(38)26(22)39)30-28(41)23(36)14-4-2-12(32)8-20(14)43-30/h1-9,21,27,29,31-35,37-41H/t21-,27-,29+/m0/s1 |
| InChIKey | KGCPHQVZVPJIOY-DGYBNRFQSA-N |
| XLogP | 3.44 |
| TPSA | 241.74 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.49 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|