C25H50O5 — CID 157253645
3,7-dihydroxy-2-(4-hydroxyphenyl)chromen-4-one;methane (PubChem CID 157253645) has the molecular formula C25H50O5 and a molecular weight of 430.67 g/mol. Its IUPAC name is 3,7-dihydroxy-2-(4-hydroxyphenyl)chromen-4-one;methane.
| Compound Name | 3,7-dihydroxy-2-(4-hydroxyphenyl)chromen-4-one;methane |
|---|---|
| PubChem CID | 157253645 |
| Molecular Formula | C25H50O5 |
| Molecular Weight | 430.67 g/mol |
| Exact Mass | 430.37 |
| IUPAC Name | 3,7-dihydroxy-2-(4-hydroxyphenyl)chromen-4-one;methane |
| SMILES | C.C.C.C.C.C.C.C.C.C.O=c1c(O)c(-c2ccc(O)cc2)oc2cc(O)ccc12 |
| InChI | InChI=1S/C15H10O5.10CH4/c16-9-3-1-8(2-4-9)15-14(19)13(18)11-6-5-10(17)7-12(11)20-15;;;;;;;;;;/h1-7,16-17,19H;10*1H4 |
| InChIKey | AWPXMZLJGZDAQD-UHFFFAOYSA-N |
| XLogP | 8.94 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.67 |
| LogP ≤ 5 | 8.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |