C15H12O7 — CID 121233655
3,7,8-trihydroxy-2-(4-hydroxyphenyl)chromen-4-one;hydrate (PubChem CID 121233655) has the molecular formula C15H12O7 and a molecular weight of 304.25 g/mol. Its IUPAC name is 3,7,8-trihydroxy-2-(4-hydroxyphenyl)chromen-4-one;hydrate.
| Compound Name | 3,7,8-trihydroxy-2-(4-hydroxyphenyl)chromen-4-one;hydrate |
|---|---|
| PubChem CID | 121233655 |
| Molecular Formula | C15H12O7 |
| Molecular Weight | 304.25 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | 3,7,8-trihydroxy-2-(4-hydroxyphenyl)chromen-4-one;hydrate |
| SMILES | O.O=c1c(O)c(-c2ccc(O)cc2)oc2c(O)c(O)ccc12 |
| InChI | InChI=1S/C15H10O6.H2O/c16-8-3-1-7(2-4-8)14-13(20)11(18)9-5-6-10(17)12(19)15(9)21-14;/h1-6,16-17,19-20H;1H2 |
| InChIKey | WTGKVEDHUZNNKC-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 142.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.25 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|