C18H15FO4 — CID 59724268
3-(4-fluorophenyl)-7,8-dihydroxy-2-propan-2-ylchromen-4-one (PubChem CID 59724268) has the molecular formula C18H15FO4 and a molecular weight of 314.31 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-7,8-dihydroxy-2-propan-2-ylchromen-4-one.
| Compound Name | 3-(4-fluorophenyl)-7,8-dihydroxy-2-propan-2-ylchromen-4-one |
|---|---|
| PubChem CID | 59724268 |
| Molecular Formula | C18H15FO4 |
| Molecular Weight | 314.31 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | 3-(4-fluorophenyl)-7,8-dihydroxy-2-propan-2-ylchromen-4-one |
| SMILES | CC(C)c1oc2c(O)c(O)ccc2c(=O)c1-c1ccc(F)cc1 |
| InChI | InChI=1S/C18H15FO4/c1-9(2)17-14(10-3-5-11(19)6-4-10)15(21)12-7-8-13(20)16(22)18(12)23-17/h3-9,20,22H,1-2H3 |
| InChIKey | COJITEALSMSCSQ-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.31 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|