C23H24FNO5 — CID 6916023
2-[[3-(4-fluorophenyl)-7-hydroxy-2-methyl-4-oxochromen-8-yl]methylazaniumyl]-4-methylpentanoate (PubChem CID 6916023) has the molecular formula C23H24FNO5 and a molecular weight of 413.45 g/mol. Its IUPAC name is 2-[[3-(4-fluorophenyl)-7-hydroxy-2-methyl-4-oxochromen-8-yl]methylazaniumyl]-4-methylpentanoate.
| Compound Name | 2-[[3-(4-fluorophenyl)-7-hydroxy-2-methyl-4-oxochromen-8-yl]methylazaniumyl]-4-methylpentanoate |
|---|---|
| PubChem CID | 6916023 |
| Molecular Formula | C23H24FNO5 |
| Molecular Weight | 413.45 g/mol |
| Exact Mass | 413.16 |
| IUPAC Name | 2-[[3-(4-fluorophenyl)-7-hydroxy-2-methyl-4-oxochromen-8-yl]methylazaniumyl]-4-methylpentanoate |
| SMILES | Cc1oc2c(C[NH2+]C(CC(C)C)C(=O)[O-])c(O)ccc2c(=O)c1-c1ccc(F)cc1 |
| InChI | InChI=1S/C23H24FNO5/c1-12(2)10-18(23(28)29)25-11-17-19(26)9-8-16-21(27)20(13(3)30-22(16)17)14-4-6-15(24)7-5-14/h4-9,12,18,25-26H,10-11H2,1-3H3,(H,28,29) |
| InChIKey | NCWPGEIAASUJKV-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 107.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.45 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|