C23H23NO5 — CID 7081409
(2S)-2-[(3-hydroxy-6-oxo-7,8,9,10-tetrahydrobenzo[c]chromen-4-yl)methylazaniumyl]-3-phenylpropanoate (PubChem CID 7081409) has the molecular formula C23H23NO5 and a molecular weight of 393.44 g/mol. Its IUPAC name is (2S)-2-[(3-hydroxy-6-oxo-7,8,9,10-tetrahydrobenzo[c]chromen-4-yl)methylazaniumyl]-3-phenylpropanoate.
| Compound Name | (2S)-2-[(3-hydroxy-6-oxo-7,8,9,10-tetrahydrobenzo[c]chromen-4-yl)methylazaniumyl]-3-phenylpropanoate |
|---|---|
| PubChem CID | 7081409 |
| Molecular Formula | C23H23NO5 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | (2S)-2-[(3-hydroxy-6-oxo-7,8,9,10-tetrahydrobenzo[c]chromen-4-yl)methylazaniumyl]-3-phenylpropanoate |
| SMILES | O=C([O-])[C@H](Cc1ccccc1)[NH2+]Cc1c(O)ccc2c3c(c(=O)oc12)CCCC3 |
| InChI | InChI=1S/C23H23NO5/c25-20-11-10-16-15-8-4-5-9-17(15)23(28)29-21(16)18(20)13-24-19(22(26)27)12-14-6-2-1-3-7-14/h1-3,6-7,10-11,19,24-25H,4-5,8-9,12-13H2,(H,26,27)/t19-/m0/s1 |
| InChIKey | XKZOQPCOAKEAMA-IBGZPJMESA-N |
| XLogP | 0.80 |
| TPSA | 107.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|