C17H22NO3+ — CID 6078864
diethyl-[(7-hydroxy-4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-6-yl)methyl]azanium (PubChem CID 6078864) has the molecular formula C17H22NO3+ and a molecular weight of 288.37 g/mol. Its IUPAC name is diethyl-[(7-hydroxy-4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-6-yl)methyl]azanium.
| Compound Name | diethyl-[(7-hydroxy-4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-6-yl)methyl]azanium |
|---|---|
| PubChem CID | 6078864 |
| Molecular Formula | C17H22NO3+ |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | diethyl-[(7-hydroxy-4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-6-yl)methyl]azanium |
| SMILES | CC[NH+](CC)Cc1c(O)ccc2c3c(c(=O)oc12)CCC3 |
| InChI | InChI=1S/C17H21NO3/c1-3-18(4-2)10-14-15(19)9-8-12-11-6-5-7-13(11)17(20)21-16(12)14/h8-9,19H,3-7,10H2,1-2H3/p+1 |
| InChIKey | CWSLBSAUYNSGBB-UHFFFAOYSA-O |
| XLogP | 1.41 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|