C15H18NO3+ — CID 6984327
(7-hydroxy-4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-6-yl)methyl-dimethylazanium (PubChem CID 6984327) has the molecular formula C15H18NO3+ and a molecular weight of 260.31 g/mol. Its IUPAC name is (7-hydroxy-4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-6-yl)methyl-dimethylazanium.
| Compound Name | (7-hydroxy-4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-6-yl)methyl-dimethylazanium |
|---|---|
| PubChem CID | 6984327 |
| Molecular Formula | C15H18NO3+ |
| Molecular Weight | 260.31 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | (7-hydroxy-4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-6-yl)methyl-dimethylazanium |
| SMILES | C[NH+](C)Cc1c(O)ccc2c3c(c(=O)oc12)CCC3 |
| InChI | InChI=1S/C15H17NO3/c1-16(2)8-12-13(17)7-6-10-9-4-3-5-11(9)15(18)19-14(10)12/h6-7,17H,3-5,8H2,1-2H3/p+1 |
| InChIKey | IMYUKKJOLAHMQD-UHFFFAOYSA-O |
| XLogP | 0.63 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.31 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|